C76H85Cl3N10O9S4 — CID 159214049
CID 159214049 (PubChem CID 159214049) has the molecular formula C76H85Cl3N10O9S4 and a molecular weight of 1517.20 g/mol.
| Compound Name | CID 159214049 |
|---|---|
| PubChem CID | 159214049 |
| Molecular Formula | C76H85Cl3N10O9S4 |
| Molecular Weight | 1517.20 g/mol |
| Exact Mass | 1514.44 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)N1CCC(C2=C3[N-]C=CC=C3C=C(CCCn3ccnc3)c3cc(Cl)ccc32)CC1.CS(=O)(=O)N1CCC(c2c3ncccc3cc(CCCn3ccnc3)[c+]3cc(Cl)ccc23)CC1.CS(=O)(=O)OCCCC1=Cc2cccnc2C(C2CCN(S(C)(=O)=O)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/2C26H28ClN4O2S.C24H29ClN2O5S2/c2*1-34(32,33)31-13-8-19(9-14-31)25-23-7-6-22(27)17-24(23)20(5-3-12-30-15-11-28-18-30)16-21-4-2-10-29-26(21)25;1-33(28,29)27-12-9-17(10-13-27)23-21-8-7-20(25)16-22(21)18(6-4-14-32-34(2,30)31)15-19-5-3-11-26-24(19)23/h2*2,4,6-7,10-11,15-19H,3,5,8-9,12-14H2,1H3;3,5,7-8,11,15-17,23H,4,6,9-10,12-14H2,1-2H3/q-1;+1; |
| InChIKey | KQVPUIYXWDPICV-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 231.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 102 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1517.20 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|