C4Cl4F4 — CID 15921460
1,1,3,3-tetrachloro-2,4,4,4-tetrafluorobut-1-ene (PubChem CID 15921460) has the molecular formula C4Cl4F4 and a molecular weight of 265.85 g/mol. Its IUPAC name is 1,1,3,3-tetrachloro-2,4,4,4-tetrafluorobut-1-ene.
| Compound Name | 1,1,3,3-tetrachloro-2,4,4,4-tetrafluorobut-1-ene |
|---|---|
| PubChem CID | 15921460 |
| Molecular Formula | C4Cl4F4 |
| Molecular Weight | 265.85 g/mol |
| Exact Mass | 263.87 |
| IUPAC Name | 1,1,3,3-tetrachloro-2,4,4,4-tetrafluorobut-1-ene |
| SMILES | FC(=C(Cl)Cl)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C4Cl4F4/c5-2(6)1(9)3(7,8)4(10,11)12 |
| InChIKey | WPDZYPIUOHHHBL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|