C18H16F2N4O5 — CID 159216433
8-fluoro-6-nitro-3,4-dihydro-1H-quinolin-2-one;8-fluoro-6-nitro-1,2,3,4-tetrahydroquinoline (PubChem CID 159216433) has the molecular formula C18H16F2N4O5 and a molecular weight of 406.35 g/mol. Its IUPAC name is 8-fluoro-6-nitro-3,4-dihydro-1H-quinolin-2-one;8-fluoro-6-nitro-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-fluoro-6-nitro-3,4-dihydro-1H-quinolin-2-one;8-fluoro-6-nitro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 159216433 |
| Molecular Formula | C18H16F2N4O5 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 8-fluoro-6-nitro-3,4-dihydro-1H-quinolin-2-one;8-fluoro-6-nitro-1,2,3,4-tetrahydroquinoline |
| SMILES | O=C1CCc2cc([N+](=O)[O-])cc(F)c2N1.O=[N+]([O-])c1cc(F)c2c(c1)CCCN2 |
| InChI | InChI=1S/C9H7FN2O3.C9H9FN2O2/c10-7-4-6(12(14)15)3-5-1-2-8(13)11-9(5)7;10-8-5-7(12(13)14)4-6-2-1-3-11-9(6)8/h3-4H,1-2H2,(H,11,13);4-5,11H,1-3H2 |
| InChIKey | KRDBESQRZLNDRC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|