C44H52N6O8 — CID 159218154
2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-1-one;2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pent-4-en-1-one (PubChem CID 159218154) has the molecular formula C44H52N6O8 and a molecular weight of 792.93 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-1-one;2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pent-4-en-1-one.
| Compound Name | 2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-1-one;2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 159218154 |
| Molecular Formula | C44H52N6O8 |
| Molecular Weight | 792.93 g/mol |
| Exact Mass | 792.38 |
| IUPAC Name | 2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pentan-1-one;2,2-dimethyl-1-[2-(3,4,5-trimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]pent-4-en-1-one |
| SMILES | C=CCC(C)(C)C(=O)c1c[nH]c2ncc(-c3cc(OC)c(OC)c(OC)c3)nc12.CCCC(C)(C)C(=O)c1c[nH]c2ncc(-c3cc(OC)c(OC)c(OC)c3)nc12 |
| InChI | InChI=1S/C22H27N3O4.C22H25N3O4/c2*1-7-8-22(2,3)20(26)14-11-23-21-18(14)25-15(12-24-21)13-9-16(27-4)19(29-6)17(10-13)28-5/h9-12H,7-8H2,1-6H3,(H,23,24);7,9-12H,1,8H2,2-6H3,(H,23,24) |
| InChIKey | KRINWLKQQTYDOB-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 172.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.93 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|