C18H20F2N2 — CID 159218815
(1R,8S)-5-(2,6-difluorophenyl)-1-methyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene;ethane (PubChem CID 159218815) has the molecular formula C18H20F2N2 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1R,8S)-5-(2,6-difluorophenyl)-1-methyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene;ethane.
| Compound Name | (1R,8S)-5-(2,6-difluorophenyl)-1-methyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene;ethane |
|---|---|
| PubChem CID | 159218815 |
| Molecular Formula | C18H20F2N2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (1R,8S)-5-(2,6-difluorophenyl)-1-methyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene;ethane |
| SMILES | CC.C[C@@]12CC[C@@H](C1)c1cc(-c3c(F)cccc3F)nnc12 |
| InChI | InChI=1S/C16H14F2N2.C2H6/c1-16-6-5-9(8-16)10-7-13(19-20-15(10)16)14-11(17)3-2-4-12(14)18;1-2/h2-4,7,9H,5-6,8H2,1H3;1-2H3/t9-,16+;/m0./s1 |
| InChIKey | KRKPFGVKJCPFTH-QDOFGCGHSA-N |
| XLogP | 4.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |