C35H52N4O6 — CID 159218997
tert-butyl 4-[5-(2-deuteriopropan-2-yloxy)-2-methyl-4-nitrophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate;2-(2-deuteriopropan-2-yloxy)-5-methyl-4-piperidin-4-ylaniline (PubChem CID 159218997) has the molecular formula C35H52N4O6 and a molecular weight of 626.84 g/mol. Its IUPAC name is tert-butyl 4-[5-(2-deuteriopropan-2-yloxy)-2-methyl-4-nitrophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate;2-(2-deuteriopropan-2-yloxy)-5-methyl-4-piperidin-4-ylaniline.
| Compound Name | tert-butyl 4-[5-(2-deuteriopropan-2-yloxy)-2-methyl-4-nitrophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate;2-(2-deuteriopropan-2-yloxy)-5-methyl-4-piperidin-4-ylaniline |
|---|---|
| PubChem CID | 159218997 |
| Molecular Formula | C35H52N4O6 |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.40 |
| IUPAC Name | tert-butyl 4-[5-(2-deuteriopropan-2-yloxy)-2-methyl-4-nitrophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate;2-(2-deuteriopropan-2-yloxy)-5-methyl-4-piperidin-4-ylaniline |
| SMILES | [2H]C(C)(C)Oc1cc(C2=CCN(C(=O)OC(C)(C)C)CC2)c(C)cc1[N+](=O)[O-].[2H]C(C)(C)Oc1cc(C2CCNCC2)c(C)cc1N |
| InChI | InChI=1S/C20H28N2O5.C15H24N2O/c1-13(2)26-18-12-16(14(3)11-17(18)22(24)25)15-7-9-21(10-8-15)19(23)27-20(4,5)6;1-10(2)18-15-9-13(11(3)8-14(15)16)12-4-6-17-7-5-12/h7,11-13H,8-10H2,1-6H3;8-10,12,17H,4-7,16H2,1-3H3/i13D;10D |
| InChIKey | KRLCRRVKUADOPB-DGODBUTJSA-N |
| XLogP | 7.55 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|