C3BrCl3F4 — CID 15921925
1-bromo-1,1,3-trichloro-2,2,3,3-tetrafluoropropane (PubChem CID 15921925) has the molecular formula C3BrCl3F4 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-bromo-1,1,3-trichloro-2,2,3,3-tetrafluoropropane.
| Compound Name | 1-bromo-1,1,3-trichloro-2,2,3,3-tetrafluoropropane |
|---|---|
| PubChem CID | 15921925 |
| Molecular Formula | C3BrCl3F4 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 295.82 |
| IUPAC Name | 1-bromo-1,1,3-trichloro-2,2,3,3-tetrafluoropropane |
| SMILES | FC(F)(Cl)C(F)(F)C(Cl)(Cl)Br |
| InChI | InChI=1S/C3BrCl3F4/c4-2(5,6)1(8,9)3(7,10)11 |
| InChIKey | NIOSZFGLOHSDHR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|