C40H27Cl3N4O4 — CID 159219566
2-[(1S)-1-(8-chloro-2-ethenylquinolin-3-yl)ethyl]isoindole-1,3-dione;2-[(1S)-1-(2,8-dichloroquinolin-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 159219566) has the molecular formula C40H27Cl3N4O4 and a molecular weight of 734.04 g/mol. Its IUPAC name is 2-[(1S)-1-(8-chloro-2-ethenylquinolin-3-yl)ethyl]isoindole-1,3-dione;2-[(1S)-1-(2,8-dichloroquinolin-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-(8-chloro-2-ethenylquinolin-3-yl)ethyl]isoindole-1,3-dione;2-[(1S)-1-(2,8-dichloroquinolin-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 159219566 |
| Molecular Formula | C40H27Cl3N4O4 |
| Molecular Weight | 734.04 g/mol |
| Exact Mass | 732.11 |
| IUPAC Name | 2-[(1S)-1-(8-chloro-2-ethenylquinolin-3-yl)ethyl]isoindole-1,3-dione;2-[(1S)-1-(2,8-dichloroquinolin-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | C=Cc1nc2c(Cl)cccc2cc1[C@H](C)N1C(=O)c2ccccc2C1=O.C[C@@H](c1cc2cccc(Cl)c2nc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H15ClN2O2.C19H12Cl2N2O2/c1-3-18-16(11-13-7-6-10-17(22)19(13)23-18)12(2)24-20(25)14-8-4-5-9-15(14)21(24)26;1-10(23-18(24)12-6-2-3-7-13(12)19(23)25)14-9-11-5-4-8-15(20)16(11)22-17(14)21/h3-12H,1H2,2H3;2-10H,1H3/t12-;10-/m00/s1 |
| InChIKey | KRMZBZDKMRATRA-PYHFHJASSA-N |
| XLogP | 9.79 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.04 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|