About trimethylsulfanium formate
trimethylsulfanium formate (PubChem CID 159220016) has the molecular formula C4H10O2S
and a molecular weight of 122.19 g/mol. Its IUPAC name is trimethylsulfanium formate.
Molecular Properties
| Compound Name | trimethylsulfanium formate |
| PubChem CID | 159220016 |
| Molecular Formula | C4H10O2S |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | trimethylsulfanium formate |
| SMILES | C[S+](C)C.O=C[O-] |
| InChI | InChI=1S/C3H9S.CH2O2/c1-4(2)3;2-1-3/h1-3H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | KROHOPPMIQDNOZ-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze trimethylsulfanium formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsulfanium formate?
The IUPAC name of trimethylsulfanium formate (CID 159220016) is trimethylsulfanium formate.
What is the SMILES notation for trimethylsulfanium formate?
The canonical SMILES for trimethylsulfanium formate is C[S+](C)C.O=C[O-].
What is the InChIKey of trimethylsulfanium formate?
The InChIKey is KROHOPPMIQDNOZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9S.CH2O2/c1-4(2)3;2-1-3/h1-3H3;1H,(H,2,3)/q+1;/p-1.
What are the key properties of trimethylsulfanium formate?
trimethylsulfanium formate has a molecular weight of 122.19 g/mol, XLogP of -1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsulfanium formate is sourced from PubChem (CID 159220016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).