C10H12Br2O2 — CID 15922148
(3aR,5aR,6aR,6bS)-6,6-dibromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole (PubChem CID 15922148) has the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. Its IUPAC name is (3aR,5aR,6aR,6bS)-6,6-dibromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole.
| Compound Name | (3aR,5aR,6aR,6bS)-6,6-dibromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole |
|---|---|
| PubChem CID | 15922148 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | (3aR,5aR,6aR,6bS)-6,6-dibromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole |
| SMILES | CC1(C)O[C@H]2[C@H]3[C@@H](C=C[C@H]2O1)C3(Br)Br |
| InChI | InChI=1S/C10H12Br2O2/c1-9(2)13-6-4-3-5-7(8(6)14-9)10(5,11)12/h3-8H,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | KYWKDROQVRTCTN-WCTZXXKLSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|