C17H20N2O4 — CID 159221639
(2S,5R)-2-benzyl-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-7-one;carbon dioxide (PubChem CID 159221639) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (2S,5R)-2-benzyl-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-7-one;carbon dioxide.
| Compound Name | (2S,5R)-2-benzyl-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-7-one;carbon dioxide |
|---|---|
| PubChem CID | 159221639 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2S,5R)-2-benzyl-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-7-one;carbon dioxide |
| SMILES | C=CCON1C(=O)N2C[C@H]1CC[C@H]2Cc1ccccc1.O=C=O |
| InChI | InChI=1S/C16H20N2O2.CO2/c1-2-10-20-18-15-9-8-14(17(12-15)16(18)19)11-13-6-4-3-5-7-13;2-1-3/h2-7,14-15H,1,8-12H2;/t14-,15+;/m0./s1 |
| InChIKey | KRTOOZDEZDKMOJ-LDXVYITESA-N |
| XLogP | 2.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|