About 6-methyl-9,10-dioxoanthracene-2-sulfinate
6-methyl-9,10-dioxoanthracene-2-sulfinate (PubChem CID 159222420) has the molecular formula C15H9O4S-
and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-methyl-9,10-dioxoanthracene-2-sulfinate.
Molecular Properties
| Compound Name | 6-methyl-9,10-dioxoanthracene-2-sulfinate |
| PubChem CID | 159222420 |
| Molecular Formula | C15H9O4S- |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 6-methyl-9,10-dioxoanthracene-2-sulfinate |
| SMILES | Cc1ccc2c(c1)C(=O)c1ccc(S(=O)[O-])cc1C2=O |
| InChI | InChI=1S/C15H10O4S/c1-8-2-4-10-12(6-8)14(16)11-5-3-9(20(18)19)7-13(11)15(10)17/h2-7H,1H3,(H,18,19)/p-1 |
| InChIKey | KRWBJNQLQNENDX-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-9,10-dioxoanthracene-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-9,10-dioxoanthracene-2-sulfinate?
The IUPAC name of 6-methyl-9,10-dioxoanthracene-2-sulfinate (CID 159222420) is 6-methyl-9,10-dioxoanthracene-2-sulfinate.
What is the SMILES notation for 6-methyl-9,10-dioxoanthracene-2-sulfinate?
The canonical SMILES for 6-methyl-9,10-dioxoanthracene-2-sulfinate is Cc1ccc2c(c1)C(=O)c1ccc(S(=O)[O-])cc1C2=O.
What is the InChIKey of 6-methyl-9,10-dioxoanthracene-2-sulfinate?
The InChIKey is KRWBJNQLQNENDX-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H10O4S/c1-8-2-4-10-12(6-8)14(16)11-5-3-9(20(18)19)7-13(11)15(10)17/h2-7H,1H3,(H,18,19)/p-1.
What are the key properties of 6-methyl-9,10-dioxoanthracene-2-sulfinate?
6-methyl-9,10-dioxoanthracene-2-sulfinate has a molecular weight of 285.30 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-9,10-dioxoanthracene-2-sulfinate is sourced from PubChem (CID 159222420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).