C40H48O9S3 — CID 159223401
2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl methanesulfonate;ethyl 2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;methane (PubChem CID 159223401) has the molecular formula C40H48O9S3 and a molecular weight of 769.02 g/mol. Its IUPAC name is 2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl methanesulfonate;ethyl 2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;methane.
| Compound Name | 2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl methanesulfonate;ethyl 2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;methane |
|---|---|
| PubChem CID | 159223401 |
| Molecular Formula | C40H48O9S3 |
| Molecular Weight | 769.02 g/mol |
| Exact Mass | 768.25 |
| IUPAC Name | 2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl methanesulfonate;ethyl 2-[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetate;methane |
| SMILES | C.CCOC(=O)CC1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21.CS(=O)(=O)OCCC1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C20H22O4S.C19H22O5S2.CH4/c1-2-24-20(21)14-16-8-6-7-15-13-18(11-12-19(15)16)25(22,23)17-9-4-3-5-10-17;1-25(20,21)24-13-12-15-6-5-7-16-14-18(10-11-19(15)16)26(22,23)17-8-3-2-4-9-17;/h3-5,9-13,16H,2,6-8,14H2,1H3;2-4,8-11,14-15H,5-7,12-13H2,1H3;1H4 |
| InChIKey | KRZFAHYXXORHHX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 137.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.02 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|