About ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole
ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole (PubChem CID 159223777) has the molecular formula C11H23N3O4P-
and a molecular weight of 292.30 g/mol. Its IUPAC name is ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole.
Molecular Properties
| Compound Name | ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole |
| PubChem CID | 159223777 |
| Molecular Formula | C11H23N3O4P- |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole |
| SMILES | C=P([O-])(OC)OCC.COCCCCn1ccnn1 |
| InChI | InChI=1S/C7H13N3O.C4H10O3P/c1-11-7-3-2-5-10-6-4-8-9-10;1-4-7-8(3,5)6-2/h4,6H,2-3,5,7H2,1H3;3-4H2,1-2H3/q;-1 |
| InChIKey | KSAGVPNQGCCZAY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole?
The IUPAC name of ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole (CID 159223777) is ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole.
What is the SMILES notation for ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole?
The canonical SMILES for ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole is C=P([O-])(OC)OCC.COCCCCn1ccnn1.
What is the InChIKey of ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole?
The InChIKey is KSAGVPNQGCCZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O.C4H10O3P/c1-11-7-3-2-5-10-6-4-8-9-10;1-4-7-8(3,5)6-2/h4,6H,2-3,5,7H2,1H3;3-4H2,1-2H3/q;-1.
What are the key properties of ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole?
ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole has a molecular weight of 292.30 g/mol, XLogP of 0.93, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-methoxy-methylidene-oxido-λ5-phosphane;1-(4-methoxybutyl)triazole is sourced from PubChem (CID 159223777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).