C25H24Cl2IN5 — CID 159223895
2-chloro-4-[(3-imidazol-1-ylcyclohexyl)amino]-3-methylbenzonitrile;2-chloro-4-iodo-3-methylbenzonitrile (PubChem CID 159223895) has the molecular formula C25H24Cl2IN5 and a molecular weight of 592.31 g/mol. Its IUPAC name is 2-chloro-4-[(3-imidazol-1-ylcyclohexyl)amino]-3-methylbenzonitrile;2-chloro-4-iodo-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[(3-imidazol-1-ylcyclohexyl)amino]-3-methylbenzonitrile;2-chloro-4-iodo-3-methylbenzonitrile |
|---|---|
| PubChem CID | 159223895 |
| Molecular Formula | C25H24Cl2IN5 |
| Molecular Weight | 592.31 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | 2-chloro-4-[(3-imidazol-1-ylcyclohexyl)amino]-3-methylbenzonitrile;2-chloro-4-iodo-3-methylbenzonitrile |
| SMILES | Cc1c(I)ccc(C#N)c1Cl.Cc1c(NC2CCCC(n3ccnc3)C2)ccc(C#N)c1Cl |
| InChI | InChI=1S/C17H19ClN4.C8H5ClIN/c1-12-16(6-5-13(10-19)17(12)18)21-14-3-2-4-15(9-14)22-8-7-20-11-22;1-5-7(10)3-2-6(4-11)8(5)9/h5-8,11,14-15,21H,2-4,9H2,1H3;2-3H,1H3 |
| InChIKey | KSAQIXPYSZBDGV-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.31 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|