C34H33FN4O2S2 — CID 159224001
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-fluorobenzamide;N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-methylbenzamide;methane (PubChem CID 159224001) has the molecular formula C34H33FN4O2S2 and a molecular weight of 612.80 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-fluorobenzamide;N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-methylbenzamide;methane.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-fluorobenzamide;N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-methylbenzamide;methane |
|---|---|
| PubChem CID | 159224001 |
| Molecular Formula | C34H33FN4O2S2 |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-fluorobenzamide;N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-methylbenzamide;methane |
| SMILES | C.Cc1ccccc1C(=O)Nc1sc2c(c1C#N)CCCC2.N#Cc1c(NC(=O)c2cccc(F)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C17H16N2OS.C16H13FN2OS.CH4/c1-11-6-2-3-7-12(11)16(20)19-17-14(10-18)13-8-4-5-9-15(13)21-17;17-11-5-3-4-10(8-11)15(20)19-16-13(9-18)12-6-1-2-7-14(12)21-16;/h2-3,6-7H,4-5,8-9H2,1H3,(H,19,20);3-5,8H,1-2,6-7H2,(H,19,20);1H4 |
| InChIKey | KSAYUOFSQVMSPP-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |