C27H37N5O3 — CID 159224014
8-(dimethylamino)-1-(3-methoxypropyl)-3-(2-oxo-3-pyrimidin-4-ylpropyl)-8-phenyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 159224014) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is 8-(dimethylamino)-1-(3-methoxypropyl)-3-(2-oxo-3-pyrimidin-4-ylpropyl)-8-phenyl-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(dimethylamino)-1-(3-methoxypropyl)-3-(2-oxo-3-pyrimidin-4-ylpropyl)-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 159224014 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 8-(dimethylamino)-1-(3-methoxypropyl)-3-(2-oxo-3-pyrimidin-4-ylpropyl)-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | COCCCN1C(=O)N(CC(=O)Cc2ccncn2)CC12CCC(c1ccccc1)(N(C)C)CC2 |
| InChI | InChI=1S/C27H37N5O3/c1-30(2)27(22-8-5-4-6-9-22)13-11-26(12-14-27)20-31(25(34)32(26)16-7-17-35-3)19-24(33)18-23-10-15-28-21-29-23/h4-6,8-10,15,21H,7,11-14,16-20H2,1-3H3 |
| InChIKey | UCWYFNLCJYQOTE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|