About acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride
acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride (PubChem CID 159224183) has the molecular formula C11H18Cl4N3O3PS
and a molecular weight of 445.14 g/mol. Its IUPAC name is acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride.
Molecular Properties
| Compound Name | acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride |
| PubChem CID | 159224183 |
| Molecular Formula | C11H18Cl4N3O3PS |
| Molecular Weight | 445.14 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride |
| SMILES | CC#N.N#CC1CCN(S(=O)(=O)CCCCl)CC1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H15ClN2O2S.C2H3N.Cl3OP/c10-4-1-7-15(13,14)12-5-2-9(8-11)3-6-12;1-2-3;1-5(2,3)4/h9H,1-7H2;1H3; |
| InChIKey | KSBPQPGGSHKTCU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 102.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride?
The IUPAC name of acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride (CID 159224183) is acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride.
What is the SMILES notation for acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride?
The canonical SMILES for acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride is CC#N.N#CC1CCN(S(=O)(=O)CCCCl)CC1.O=P(Cl)(Cl)Cl.
What is the InChIKey of acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride?
The InChIKey is KSBPQPGGSHKTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2O2S.C2H3N.Cl3OP/c10-4-1-7-15(13,14)12-5-2-9(8-11)3-6-12;1-2-3;1-5(2,3)4/h9H,1-7H2;1H3;.
What are the key properties of acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride?
acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride has a molecular weight of 445.14 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1-(3-chloropropylsulfonyl)piperidine-4-carbonitrile;phosphoryl trichloride is sourced from PubChem (CID 159224183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).