C19H37N5O — CID 159225101
2-tert-butyl-4,5-dimethylpyrazol-3-amine;2,2-dimethylpropan-1-amine;2-methyl-3-oxobutanenitrile (PubChem CID 159225101) has the molecular formula C19H37N5O and a molecular weight of 351.54 g/mol. Its IUPAC name is 2-tert-butyl-4,5-dimethylpyrazol-3-amine;2,2-dimethylpropan-1-amine;2-methyl-3-oxobutanenitrile.
| Compound Name | 2-tert-butyl-4,5-dimethylpyrazol-3-amine;2,2-dimethylpropan-1-amine;2-methyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 159225101 |
| Molecular Formula | C19H37N5O |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | 2-tert-butyl-4,5-dimethylpyrazol-3-amine;2,2-dimethylpropan-1-amine;2-methyl-3-oxobutanenitrile |
| SMILES | CC(=O)C(C)C#N.CC(C)(C)CN.Cc1nn(C(C)(C)C)c(N)c1C |
| InChI | InChI=1S/C9H17N3.C5H7NO.C5H13N/c1-6-7(2)11-12(8(6)10)9(3,4)5;1-4(3-6)5(2)7;1-5(2,3)4-6/h10H2,1-5H3;4H,1-2H3;4,6H2,1-3H3 |
| InChIKey | KSEKUVLYDZZAIP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|