About [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid
[1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid (PubChem CID 159225831) has the molecular formula C15H32N2O4S
and a molecular weight of 336.50 g/mol. Its IUPAC name is [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid.
Molecular Properties
| Compound Name | [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid |
| PubChem CID | 159225831 |
| Molecular Formula | C15H32N2O4S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid |
| SMILES | CN1CCCCC1C1CCCN(C)C1(C)CO.CS(=O)(=O)O |
| InChI | InChI=1S/C14H28N2O.CH4O3S/c1-14(11-17)12(7-6-10-16(14)3)13-8-4-5-9-15(13)2;1-5(2,3)4/h12-13,17H,4-11H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | SIWDYXMNHDCWIG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid?
The IUPAC name of [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid (CID 159225831) is [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid.
What is the SMILES notation for [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid?
The canonical SMILES for [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid is CN1CCCCC1C1CCCN(C)C1(C)CO.CS(=O)(=O)O.
What is the InChIKey of [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid?
The InChIKey is SIWDYXMNHDCWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O.CH4O3S/c1-14(11-17)12(7-6-10-16(14)3)13-8-4-5-9-15(13)2;1-5(2,3)4/h12-13,17H,4-11H2,1-3H3;1H3,(H,2,3,4).
What are the key properties of [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid?
[1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid has a molecular weight of 336.50 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-dimethyl-3-(1-methylpiperidin-2-yl)piperidin-2-yl]methanol;methanesulfonic acid is sourced from PubChem (CID 159225831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).