C24H34O8 — CID 15922613
[(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12-acetyloxy-15-hydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate (PubChem CID 15922613) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12-acetyloxy-15-hydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate.
| Compound Name | [(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12-acetyloxy-15-hydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate |
|---|---|
| PubChem CID | 15922613 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12-acetyloxy-15-hydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](OC(C)=O)[C@](C)(O)C[C@@H]2O[C@H]3[C@@H]4[C@H]2C(C)=CC(=O)[C@@H]4[C@@H](C)CO[C@@]13C |
| InChI | InChI=1S/C24H34O8/c1-11-7-15(27)19-12(2)10-29-24(6)18(31-14(4)26)8-17(30-13(3)25)23(5,28)9-16-20(11)21(19)22(24)32-16/h7,12,16-22,28H,8-10H2,1-6H3/t12-,16-,17+,18+,19-,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | YIAHINSGOBHTRP-CYCJQZIMSA-N |
| XLogP | 1.96 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |