C22H32O7 — CID 15922614
[(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12,15-dihydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate (PubChem CID 15922614) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12,15-dihydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate.
| Compound Name | [(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12,15-dihydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate |
|---|---|
| PubChem CID | 15922614 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(1S,2R,3S,7R,8R,11S,12R,14R,15R,17S)-12,15-dihydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](O)[C@]2(C)OC[C@H](C)[C@H]3C(=O)C=C(C)[C@@H]4[C@H]3[C@@H]2O[C@H]4C[C@@]1(C)O |
| InChI | InChI=1S/C22H32O7/c1-10-6-13(24)17-11(2)9-27-22(5)15(25)7-16(28-12(3)23)21(4,26)8-14-18(10)19(17)20(22)29-14/h6,11,14-20,25-26H,7-9H2,1-5H3/t11-,14-,15+,16+,17-,18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | HGCHDTMKJFVBHB-GFLKERTHSA-N |
| XLogP | 1.39 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |