C32H48N2O6 — CID 159226270
(2R,5S)-2-benzyl-5-[[(2S)-2-hydroxy-5-methylhex-5-enoyl]amino]-7-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]-4-oxooctanamide (PubChem CID 159226270) has the molecular formula C32H48N2O6 and a molecular weight of 556.74 g/mol. Its IUPAC name is (2R,5S)-2-benzyl-5-[[(2S)-2-hydroxy-5-methylhex-5-enoyl]amino]-7-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]-4-oxooctanamide.
| Compound Name | (2R,5S)-2-benzyl-5-[[(2S)-2-hydroxy-5-methylhex-5-enoyl]amino]-7-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]-4-oxooctanamide |
|---|---|
| PubChem CID | 159226270 |
| Molecular Formula | C32H48N2O6 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | (2R,5S)-2-benzyl-5-[[(2S)-2-hydroxy-5-methylhex-5-enoyl]amino]-7-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]-4-oxooctanamide |
| SMILES | C=C(C)CC[C@H](O)C(=O)N[C@@H](CC(C)C)C(=O)C[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C32H48N2O6/c1-20(2)13-14-27(35)31(39)33-25(15-21(3)4)28(36)18-24(17-23-11-9-8-10-12-23)30(38)34-26(16-22(5)6)29(37)32(7)19-40-32/h8-12,21-22,24-27,35H,1,13-19H2,2-7H3,(H,33,39)(H,34,38)/t24-,25+,26+,27+,32-/m1/s1 |
| InChIKey | AHQRXQGQRJPSFB-JGJURLCNSA-N |
| XLogP | 3.94 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|