C36H42BF2N3O5 — CID 159226917
methyl N-[(2S)-1-[(6S)-6-[4-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-3H-pyrrol-2-yl]-5-azaspiro[2.4]heptan-5-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 159226917) has the molecular formula C36H42BF2N3O5 and a molecular weight of 645.56 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(6S)-6-[4-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-3H-pyrrol-2-yl]-5-azaspiro[2.4]heptan-5-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(6S)-6-[4-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-3H-pyrrol-2-yl]-5-azaspiro[2.4]heptan-5-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 159226917 |
| Molecular Formula | C36H42BF2N3O5 |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | methyl N-[(2S)-1-[(6S)-6-[4-[9,9-difluoro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-3H-pyrrol-2-yl]-5-azaspiro[2.4]heptan-5-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CC2(CC2)C[C@H]1C1=NC=C(c2ccc3c(c2)C(F)(F)c2cc(B4OC(C)(C)C(C)(C)O4)ccc2-3)C1)C(C)C |
| InChI | InChI=1S/C36H42BF2N3O5/c1-20(2)30(41-32(44)45-7)31(43)42-19-35(12-13-35)17-29(42)28-15-22(18-40-28)21-8-10-24-25-11-9-23(16-27(25)36(38,39)26(24)14-21)37-46-33(3,4)34(5,6)47-37/h8-11,14,16,18,20,29-30H,12-13,15,17,19H2,1-7H3,(H,41,44)/t29-,30-/m0/s1 |
| InChIKey | LLUBFTQHZWJZMZ-KYJUHHDHSA-N |
| XLogP | 6.05 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|