C34H43F3N2O5 — CID 159227372
N-cycloheptyl-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]-3-(2-phenylethoxy)propanamide;2,2,2-trifluoroacetaldehyde (PubChem CID 159227372) has the molecular formula C34H43F3N2O5 and a molecular weight of 616.72 g/mol. Its IUPAC name is N-cycloheptyl-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]-3-(2-phenylethoxy)propanamide;2,2,2-trifluoroacetaldehyde.
| Compound Name | N-cycloheptyl-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]-3-(2-phenylethoxy)propanamide;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159227372 |
| Molecular Formula | C34H43F3N2O5 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | N-cycloheptyl-N-[5-(8-hydroxy-2-oxo-1H-quinolin-5-yl)pentyl]-3-(2-phenylethoxy)propanamide;2,2,2-trifluoroacetaldehyde |
| SMILES | O=C(CCOCCc1ccccc1)N(CCCCCc1ccc(O)c2[nH]c(=O)ccc12)C1CCCCCC1.O=CC(F)(F)F |
| InChI | InChI=1S/C32H42N2O4.C2HF3O/c35-29-18-16-26(28-17-19-30(36)33-32(28)29)13-7-4-10-22-34(27-14-8-1-2-9-15-27)31(37)21-24-38-23-20-25-11-5-3-6-12-25;3-2(4,5)1-6/h3,5-6,11-12,16-19,27,35H,1-2,4,7-10,13-15,20-24H2,(H,33,36);1H |
| InChIKey | KSLPGROBPXXBLK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|