C33H11ClN2 — CID 159227516
5-chloro-6-methyl-1H-benzimidazole;pentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecayne (PubChem CID 159227516) has the molecular formula C33H11ClN2 and a molecular weight of 470.92 g/mol. Its IUPAC name is 5-chloro-6-methyl-1H-benzimidazole;pentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecayne.
| Compound Name | 5-chloro-6-methyl-1H-benzimidazole;pentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecayne |
|---|---|
| PubChem CID | 159227516 |
| Molecular Formula | C33H11ClN2 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 5-chloro-6-methyl-1H-benzimidazole;pentacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecayne |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.Cc1cc2[nH]cnc2cc1Cl |
| InChI | InChI=1S/C25H4.C8H7ClN2/c1-3-5-7-9-11-13-15-17-19-21-23-25-24-22-20-18-16-14-12-10-8-6-4-2;1-5-2-7-8(3-6(5)9)11-4-10-7/h1H,2H3;2-4H,1H3,(H,10,11) |
| InChIKey | KSMBTBWQGSGHNJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|