About N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid
N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid (PubChem CID 159227536) has the molecular formula C25H39N3O3
and a molecular weight of 429.61 g/mol. Its IUPAC name is N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid.
Molecular Properties
| Compound Name | N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid |
| PubChem CID | 159227536 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid |
| SMILES | CCCCCCCCCCNC1CN2CCC1CC2.O=C(O)c1cc2ccoc2cn1 |
| InChI | InChI=1S/C17H34N2.C8H5NO3/c1-2-3-4-5-6-7-8-9-12-18-17-15-19-13-10-16(17)11-14-19;10-8(11)6-3-5-1-2-12-7(5)4-9-6/h16-18H,2-15H2,1H3;1-4H,(H,10,11) |
| InChIKey | KSMDKGLXCXEUIS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid?
The IUPAC name of N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid (CID 159227536) is N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid.
What is the SMILES notation for N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid?
The canonical SMILES for N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid is CCCCCCCCCCNC1CN2CCC1CC2.O=C(O)c1cc2ccoc2cn1.
What is the InChIKey of N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid?
The InChIKey is KSMDKGLXCXEUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2.C8H5NO3/c1-2-3-4-5-6-7-8-9-12-18-17-15-19-13-10-16(17)11-14-19;10-8(11)6-3-5-1-2-12-7(5)4-9-6/h16-18H,2-15H2,1H3;1-4H,(H,10,11).
What are the key properties of N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid?
N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid has a molecular weight of 429.61 g/mol, XLogP of 5.34, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-decyl-1-azabicyclo[2.2.2]octan-3-amine;furo[2,3-c]pyridine-5-carboxylic acid is sourced from PubChem (CID 159227536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).