About potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate
potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate (PubChem CID 159228212) has the molecular formula C6H8ClKN2O3
and a molecular weight of 230.69 g/mol. Its IUPAC name is potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate.
Molecular Properties
| Compound Name | potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate |
| PubChem CID | 159228212 |
| Molecular Formula | C6H8ClKN2O3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate |
| SMILES | CC1(CCl)CNC(=O)O1.N#C[O-].[K+] |
| InChI | InChI=1S/C5H8ClNO2.CHNO.K/c1-5(2-6)3-7-4(8)9-5;2-1-3;/h2-3H2,1H3,(H,7,8);3H;/q;;+1/p-1 |
| InChIKey | KSODGQLSNUWGHJ-UHFFFAOYSA-M |
| XLogP | -3.44 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate?
The IUPAC name of potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate (CID 159228212) is potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate.
What is the SMILES notation for potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate?
The canonical SMILES for potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate is CC1(CCl)CNC(=O)O1.N#C[O-].[K+].
What is the InChIKey of potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate?
The InChIKey is KSODGQLSNUWGHJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8ClNO2.CHNO.K/c1-5(2-6)3-7-4(8)9-5;2-1-3;/h2-3H2,1H3,(H,7,8);3H;/q;;+1/p-1.
What are the key properties of potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate?
potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate has a molecular weight of 230.69 g/mol, XLogP of -3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;5-(chloromethyl)-5-methyl-1,3-oxazolidin-2-one;cyanate is sourced from PubChem (CID 159228212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).