C35H42F4N2O7 — CID 159229247
tert-butyl (3S)-3-[[4-[[3-(2-tert-butylphenyl)-2-oxopropanoyl]amino]cyclohexanecarbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 159229247) has the molecular formula C35H42F4N2O7 and a molecular weight of 678.72 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[[3-(2-tert-butylphenyl)-2-oxopropanoyl]amino]cyclohexanecarbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl (3S)-3-[[4-[[3-(2-tert-butylphenyl)-2-oxopropanoyl]amino]cyclohexanecarbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 159229247 |
| Molecular Formula | C35H42F4N2O7 |
| Molecular Weight | 678.72 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[[3-(2-tert-butylphenyl)-2-oxopropanoyl]amino]cyclohexanecarbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)C1CCC(NC(=O)C(=O)Cc2ccccc2C(C)(C)C)CC1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C35H42F4N2O7/c1-34(2,3)22-10-8-7-9-20(22)15-26(42)33(46)40-21-13-11-19(12-14-21)32(45)41-25(17-28(44)48-35(4,5)6)27(43)18-47-31-29(38)23(36)16-24(37)30(31)39/h7-10,16,19,21,25H,11-15,17-18H2,1-6H3,(H,40,46)(H,41,45)/t19?,21?,25-/m0/s1 |
| InChIKey | UUXBBWWVHTUFTJ-AJPKXHFHSA-N |
| XLogP | 5.19 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.72 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|