C17H30NO5P — CID 159230428
[(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl [(1R)-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] phosphite (PubChem CID 159230428) has the molecular formula C17H30NO5P and a molecular weight of 364.43 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl [(1R)-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] phosphite.
| Compound Name | [(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl [(1R)-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] phosphite |
|---|---|
| PubChem CID | 159230428 |
| Molecular Formula | C17H30NO5P |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl [(1R)-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] phosphite |
| SMILES | [2H]C[C@H]1O[C@H]([3H])C[C@@H]1OP(OCC[N+]#[C-])O[C@H](CCC)[C@H]1O[C@H]([3H])C[C@@H]1C |
| InChI | InChI=1S/C17H30NO5P/c1-5-6-16(17-13(2)7-10-20-17)23-24(21-12-9-18-4)22-15-8-11-19-14(15)3/h13-17H,5-12H2,1-3H3/t13-,14+,15-,16+,17-,24?/m0/s1/i3D,10T,11T/t10-,11-,13+,14-,15+,16-,17+,24?/m1 |
| InChIKey | UYXPREPATXYOFQ-ATMQCEQTSA-N |
| XLogP | 3.95 |
| TPSA | 50.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|