C36H52Cl2N3O3+ — CID 159231131
2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3R)-2,6-dimethylheptan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetate;1-methyl-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 159231131) has the molecular formula C36H52Cl2N3O3+ and a molecular weight of 645.74 g/mol. Its IUPAC name is 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3R)-2,6-dimethylheptan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetate;1-methyl-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3R)-2,6-dimethylheptan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetate;1-methyl-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 159231131 |
| Molecular Formula | C36H52Cl2N3O3+ |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3R)-2,6-dimethylheptan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetate;1-methyl-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CC(C)CC[C@H](C(C)C)N1C(=O)[C@@](C)(CC(=O)[O-])C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1.C[N+]12CC[NH+](CC1)CC2 |
| InChI | InChI=1S/C29H37Cl2NO3.C7H15N2/c1-18(2)9-14-25(19(3)4)32-27(20-10-12-22(30)13-11-20)24(21-7-6-8-23(31)15-21)16-29(5,28(32)35)17-26(33)34;1-9-5-2-8(3-6-9)4-7-9/h6-8,10-13,15,18-19,24-25,27H,9,14,16-17H2,1-5H3,(H,33,34);2-7H2,1H3/q;+1/t24-,25-,27-,29-;/m1./s1 |
| InChIKey | KSXIKHDPHOJNOL-LRPPLHPOSA-N |
| XLogP | 5.00 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|