About carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid
carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid (PubChem CID 159231194) has the molecular formula C8H11F3N3O7P
and a molecular weight of 349.16 g/mol. Its IUPAC name is carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid |
| PubChem CID | 159231194 |
| Molecular Formula | C8H11F3N3O7P |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid |
| SMILES | FC(F)F.O=C(O)C(Cn1ccnn1)CP(=O)(O)O.O=C=O |
| InChI | InChI=1S/C6H10N3O5P.CHF3.CO2/c10-6(11)5(4-15(12,13)14)3-9-2-1-7-8-9;2-1(3)4;2-1-3/h1-2,5H,3-4H2,(H,10,11)(H2,12,13,14);1H; |
| InChIKey | KSXOGSQUCWFKIT-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 159.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid?
The IUPAC name of carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid (CID 159231194) is carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid.
What is the SMILES notation for carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid?
The canonical SMILES for carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid is FC(F)F.O=C(O)C(Cn1ccnn1)CP(=O)(O)O.O=C=O.
What is the InChIKey of carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid?
The InChIKey is KSXOGSQUCWFKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N3O5P.CHF3.CO2/c10-6(11)5(4-15(12,13)14)3-9-2-1-7-8-9;2-1(3)4;2-1-3/h1-2,5H,3-4H2,(H,10,11)(H2,12,13,14);1H;.
What are the key properties of carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid?
carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid has a molecular weight of 349.16 g/mol, XLogP of -0.25, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;fluoroform;2-(phosphonomethyl)-3-(triazol-1-yl)propanoic acid is sourced from PubChem (CID 159231194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).