C18H28O3 — CID 15923267
[(1S,4aR,8S,8aR)-5-(2-methoxypropan-2-yl)-3,8-dimethyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-yl] acetate (PubChem CID 15923267) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is [(1S,4aR,8S,8aR)-5-(2-methoxypropan-2-yl)-3,8-dimethyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-yl] acetate.
| Compound Name | [(1S,4aR,8S,8aR)-5-(2-methoxypropan-2-yl)-3,8-dimethyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 15923267 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [(1S,4aR,8S,8aR)-5-(2-methoxypropan-2-yl)-3,8-dimethyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-yl] acetate |
| SMILES | COC(C)(C)C1=CC[C@H](C)[C@H]2[C@@H](OC(C)=O)CC(C)=C[C@@H]12 |
| InChI | InChI=1S/C18H28O3/c1-11-9-14-15(18(4,5)20-6)8-7-12(2)17(14)16(10-11)21-13(3)19/h8-9,12,14,16-17H,7,10H2,1-6H3/t12-,14-,16-,17+/m0/s1 |
| InChIKey | WAXILJQBZIRBRJ-ZFZWDLNGSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|