C34H22Cl5IN4O3 — CID 159232713
5-chloro-7-iodoquinolin-8-ol;5,7-dichloro-2-ethylquinolin-8-ol;5,7-dichloro-2-pyridin-2-ylquinolin-8-ol (PubChem CID 159232713) has the molecular formula C34H22Cl5IN4O3 and a molecular weight of 838.74 g/mol. Its IUPAC name is 5-chloro-7-iodoquinolin-8-ol;5,7-dichloro-2-ethylquinolin-8-ol;5,7-dichloro-2-pyridin-2-ylquinolin-8-ol.
| Compound Name | 5-chloro-7-iodoquinolin-8-ol;5,7-dichloro-2-ethylquinolin-8-ol;5,7-dichloro-2-pyridin-2-ylquinolin-8-ol |
|---|---|
| PubChem CID | 159232713 |
| Molecular Formula | C34H22Cl5IN4O3 |
| Molecular Weight | 838.74 g/mol |
| Exact Mass | 835.92 |
| IUPAC Name | 5-chloro-7-iodoquinolin-8-ol;5,7-dichloro-2-ethylquinolin-8-ol;5,7-dichloro-2-pyridin-2-ylquinolin-8-ol |
| SMILES | CCc1ccc2c(Cl)cc(Cl)c(O)c2n1.Oc1c(Cl)cc(Cl)c2ccc(-c3ccccn3)nc12.Oc1c(I)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C14H8Cl2N2O.C11H9Cl2NO.C9H5ClINO/c15-9-7-10(16)14(19)13-8(9)4-5-12(18-13)11-3-1-2-6-17-11;1-2-6-3-4-7-8(12)5-9(13)11(15)10(7)14-6;10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-7,19H;3-5,15H,2H2,1H3;1-4,13H |
| InChIKey | KTCJVZCICYCZCI-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.74 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|