C24H42N2O3 — CID 159234425
ethyl (2S)-3-[4-[2-(tert-butylamino)ethoxy]phenyl]-2-(heptylamino)propanoate (PubChem CID 159234425) has the molecular formula C24H42N2O3 and a molecular weight of 406.61 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[2-(tert-butylamino)ethoxy]phenyl]-2-(heptylamino)propanoate.
| Compound Name | ethyl (2S)-3-[4-[2-(tert-butylamino)ethoxy]phenyl]-2-(heptylamino)propanoate |
|---|---|
| PubChem CID | 159234425 |
| Molecular Formula | C24H42N2O3 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | ethyl (2S)-3-[4-[2-(tert-butylamino)ethoxy]phenyl]-2-(heptylamino)propanoate |
| SMILES | CCCCCCCN[C@@H](Cc1ccc(OCCNC(C)(C)C)cc1)C(=O)OCC |
| InChI | InChI=1S/C24H42N2O3/c1-6-8-9-10-11-16-25-22(23(27)28-7-2)19-20-12-14-21(15-13-20)29-18-17-26-24(3,4)5/h12-15,22,25-26H,6-11,16-19H2,1-5H3/t22-/m0/s1 |
| InChIKey | TVQOHXDMVDQLBU-QFIPXVFZSA-N |
| XLogP | 4.49 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|