C11H13F4NO4 — CID 159234474
fluoromethane;methyl 2-nitrobenzoate;1,1,1-trifluoroethane (PubChem CID 159234474) has the molecular formula C11H13F4NO4 and a molecular weight of 299.22 g/mol. Its IUPAC name is fluoromethane;methyl 2-nitrobenzoate;1,1,1-trifluoroethane.
| Compound Name | fluoromethane;methyl 2-nitrobenzoate;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 159234474 |
| Molecular Formula | C11H13F4NO4 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | fluoromethane;methyl 2-nitrobenzoate;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CF.COC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO4.C2H3F3.CH3F/c1-13-8(10)6-4-2-3-5-7(6)9(11)12;1-2(3,4)5;1-2/h2-5H,1H3;1H3;1H3 |
| InChIKey | KTHLLFWBFZNQOR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|