C19H34O2Si — CID 15923494
(2S)-2-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal (PubChem CID 15923494) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is (2S)-2-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal.
| Compound Name | (2S)-2-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal |
|---|---|
| PubChem CID | 15923494 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2S)-2-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)C=O)=CC[C@@H]12 |
| InChI | InChI=1S/C19H34O2Si/c1-6-22(7-2,8-3)21-18-10-9-13-19(5)16(15(4)14-20)11-12-17(18)19/h11,14-15,17-18H,6-10,12-13H2,1-5H3/t15-,17+,18+,19-/m1/s1 |
| InChIKey | OFMNQUMPMUWHGZ-XGXHKWSGSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|