C28H37NO12 — CID 15923498
ethyl (2S)-3-phenyl-2-[3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoylamino]propanoate (PubChem CID 15923498) has the molecular formula C28H37NO12 and a molecular weight of 579.60 g/mol. Its IUPAC name is ethyl (2S)-3-phenyl-2-[3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoylamino]propanoate.
| Compound Name | ethyl (2S)-3-phenyl-2-[3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoylamino]propanoate |
|---|---|
| PubChem CID | 15923498 |
| Molecular Formula | C28H37NO12 |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | ethyl (2S)-3-phenyl-2-[3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoylamino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)CC[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H37NO12/c1-6-36-28(35)21(14-20-10-8-7-9-11-20)29-24(34)13-12-22-25(38-17(3)31)27(40-19(5)33)26(39-18(4)32)23(41-22)15-37-16(2)30/h7-11,21-23,25-27H,6,12-15H2,1-5H3,(H,29,34)/t21-,22+,23+,25-,26+,27+/m0/s1 |
| InChIKey | GAPYROIFSPKITF-ZHSJGXMJSA-N |
| XLogP | 1.18 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|