About 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride
2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride (PubChem CID 159236078) has the molecular formula C10H8Cl3N3O2S
and a molecular weight of 340.62 g/mol. Its IUPAC name is 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride |
| PubChem CID | 159236078 |
| Molecular Formula | C10H8Cl3N3O2S |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride |
| SMILES | Nc1ccnc(Cl)c1.O=S(=O)(Cl)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C5H3Cl2NO2S.C5H5ClN2/c6-5-3-4(1-2-8-5)11(7,9)10;6-5-3-4(7)1-2-8-5/h1-3H;1-3H,(H2,7,8) |
| InChIKey | KTMIELQZVFJDQS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride?
The IUPAC name of 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride (CID 159236078) is 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride.
What is the SMILES notation for 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride?
The canonical SMILES for 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride is Nc1ccnc(Cl)c1.O=S(=O)(Cl)c1ccnc(Cl)c1.
What is the InChIKey of 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride?
The InChIKey is KTMIELQZVFJDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2NO2S.C5H5ClN2/c6-5-3-4(1-2-8-5)11(7,9)10;6-5-3-4(7)1-2-8-5/h1-3H;1-3H,(H2,7,8).
What are the key properties of 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride?
2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride has a molecular weight of 340.62 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyridin-4-amine;2-chloropyridine-4-sulfonyl chloride is sourced from PubChem (CID 159236078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).