C22H18O8 — CID 15923711
methyl 4,8,11-trimethoxy-6-methyl-5,10-dioxonaphtho[3,2-f][1]benzofuran-7-carboxylate (PubChem CID 15923711) has the molecular formula C22H18O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is methyl 4,8,11-trimethoxy-6-methyl-5,10-dioxonaphtho[3,2-f][1]benzofuran-7-carboxylate.
| Compound Name | methyl 4,8,11-trimethoxy-6-methyl-5,10-dioxonaphtho[3,2-f][1]benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 15923711 |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | methyl 4,8,11-trimethoxy-6-methyl-5,10-dioxonaphtho[3,2-f][1]benzofuran-7-carboxylate |
| SMILES | COC(=O)c1c(OC)cc2c(c1C)C(=O)c1c(c(OC)c3occc3c1OC)C2=O |
| InChI | InChI=1S/C22H18O8/c1-9-13-11(8-12(26-2)14(9)22(25)29-5)17(23)15-16(18(13)24)19(27-3)10-6-7-30-20(10)21(15)28-4/h6-8H,1-5H3 |
| InChIKey | OGTTXGNXYCORFD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|