C12H26O3Si2 — CID 15923785
trimethyl-[[(2R,3S,4R)-2-methyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane (PubChem CID 15923785) has the molecular formula C12H26O3Si2 and a molecular weight of 274.51 g/mol. Its IUPAC name is trimethyl-[[(2R,3S,4R)-2-methyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane.
| Compound Name | trimethyl-[[(2R,3S,4R)-2-methyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 15923785 |
| Molecular Formula | C12H26O3Si2 |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | trimethyl-[[(2R,3S,4R)-2-methyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
| SMILES | C[C@H]1OC=C[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C12H26O3Si2/c1-10-12(15-17(5,6)7)11(8-9-13-10)14-16(2,3)4/h8-12H,1-7H3/t10-,11-,12+/m1/s1 |
| InChIKey | ZVDVITXSGFLFJS-UTUOFQBUSA-N |
| XLogP | 3.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|