C36H72F3N3 — CID 159237982
(2S,4S)-1-tert-butyl-2,4-dimethylpiperidine;(2R,4R)-1-tert-butyl-2,4-dimethylpiperidine;1,4-ditert-butyl-2-(trifluoromethyl)piperidine (PubChem CID 159237982) has the molecular formula C36H72F3N3 and a molecular weight of 603.99 g/mol. Its IUPAC name is (2S,4S)-1-tert-butyl-2,4-dimethylpiperidine;(2R,4R)-1-tert-butyl-2,4-dimethylpiperidine;1,4-ditert-butyl-2-(trifluoromethyl)piperidine.
| Compound Name | (2S,4S)-1-tert-butyl-2,4-dimethylpiperidine;(2R,4R)-1-tert-butyl-2,4-dimethylpiperidine;1,4-ditert-butyl-2-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 159237982 |
| Molecular Formula | C36H72F3N3 |
| Molecular Weight | 603.99 g/mol |
| Exact Mass | 603.57 |
| IUPAC Name | (2S,4S)-1-tert-butyl-2,4-dimethylpiperidine;(2R,4R)-1-tert-butyl-2,4-dimethylpiperidine;1,4-ditert-butyl-2-(trifluoromethyl)piperidine |
| SMILES | CC(C)(C)C1CCN(C(C)(C)C)C(C(F)(F)F)C1.C[C@@H]1CCN(C(C)(C)C)[C@H](C)C1.C[C@H]1CCN(C(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C14H26F3N.2C11H23N/c1-12(2,3)10-7-8-18(13(4,5)6)11(9-10)14(15,16)17;2*1-9-6-7-12(10(2)8-9)11(3,4)5/h10-11H,7-9H2,1-6H3;2*9-10H,6-8H2,1-5H3/t;2*9-,10-/m.10/s1 |
| InChIKey | KTSLGNOXSYOCLL-OHDFGYLZSA-N |
| XLogP | 10.28 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.99 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |