C17H22N6O — CID 159238632
1-[(3R,4R)-3,4-dideuterio-3-[(2,5-dideuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-(trideuteriomethyl)piperidin-1-yl]-2-isocyanoethanone (PubChem CID 159238632) has the molecular formula C17H22N6O and a molecular weight of 333.45 g/mol. Its IUPAC name is 1-[(3R,4R)-3,4-dideuterio-3-[(2,5-dideuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-(trideuteriomethyl)piperidin-1-yl]-2-isocyanoethanone.
| Compound Name | 1-[(3R,4R)-3,4-dideuterio-3-[(2,5-dideuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-(trideuteriomethyl)piperidin-1-yl]-2-isocyanoethanone |
|---|---|
| PubChem CID | 159238632 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-[(3R,4R)-3,4-dideuterio-3-[(2,5-dideuterio-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-methylamino]-4-(trideuteriomethyl)piperidin-1-yl]-2-isocyanoethanone |
| SMILES | [2H]c1nc(N(C)[C@@]2([2H])CN(C(=O)C[N+]#[C-])CC[C@@]2([2H])C([2H])([2H])[2H])c2c([2H])c(C)[nH]c2n1 |
| InChI | InChI=1S/C17H22N6O/c1-11-5-6-23(15(24)8-18-3)9-14(11)22(4)17-13-7-12(2)21-16(13)19-10-20-17/h7,10-11,14H,5-6,8-9H2,1-2,4H3,(H,19,20,21)/t11-,14+/m1/s1/i1D3,7D,10D,11D,14D |
| InChIKey | YSHXCOZZOBGGME-IYGVQJQDSA-N |
| XLogP | 1.86 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|