C24H40O8 — CID 159239338
(3aR,6S,7R,7aR)-6-ethenyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(3S,4R)-4-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol (PubChem CID 159239338) has the molecular formula C24H40O8 and a molecular weight of 456.58 g/mol. Its IUPAC name is (3aR,6S,7R,7aR)-6-ethenyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(3S,4R)-4-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol.
| Compound Name | (3aR,6S,7R,7aR)-6-ethenyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(3S,4R)-4-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 159239338 |
| Molecular Formula | C24H40O8 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (3aR,6S,7R,7aR)-6-ethenyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one;(3S,4R)-4-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol |
| SMILES | C=C[C@](C)(O)[C@H](C)[C@H]1OC(C)(C)O[C@H]1CO.C=C[C@]1(C)OC(=O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C12H18O4.C12H22O4/c1-6-12(5)7(2)8-9(10(13)16-12)15-11(3,4)14-8;1-6-12(5,14)8(2)10-9(7-13)15-11(3,4)16-10/h6-9H,1H2,2-5H3;6,8-10,13-14H,1,7H2,2-5H3/t7-,8-,9-,12+;8-,9+,10-,12+/m11/s1 |
| InChIKey | KTWMVSHSYKOBMG-SMQWLYLPSA-N |
| XLogP | 2.72 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|