C19H31NO4 — CID 159239823
1-hexylpyrrolidine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 159239823) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-hexylpyrrolidine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-hexylpyrrolidine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 159239823 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-hexylpyrrolidine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCCCN1CCCC1 |
| InChI | InChI=1S/C10H21N.C9H10O4/c1-2-3-4-5-8-11-9-6-7-10-11;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h2-10H2,1H3;2-4H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | KTYASYGUVZWQNN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|