C32H52F2O5Si — CID 159240004
(4-methoxyphenyl)methyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate (PubChem CID 159240004) has the molecular formula C32H52F2O5Si and a molecular weight of 582.85 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate.
| Compound Name | (4-methoxyphenyl)methyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 159240004 |
| Molecular Formula | C32H52F2O5Si |
| Molecular Weight | 582.85 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | (4-methoxyphenyl)methyl 7-[(1R,2S,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-3-methyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(CC[C@H]1[C@H](C)CC(=O)[C@@H]1CCCCCCC(=O)OCc1ccc(OC)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C32H52F2O5Si/c1-7-8-21-32(33,34)30(39-40(4,5)6)20-19-27-24(2)22-29(35)28(27)13-11-9-10-12-14-31(36)38-23-25-15-17-26(37-3)18-16-25/h15-18,24,27-28,30H,7-14,19-23H2,1-6H3/t24-,27+,28-,30?/m1/s1 |
| InChIKey | KTYQQEKEFGDJEQ-WYOHFNSMSA-N |
| XLogP | 8.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.85 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|