About 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea
1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea (PubChem CID 159240113) has the molecular formula C21H37N3O4S
and a molecular weight of 427.61 g/mol. Its IUPAC name is 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea.
Molecular Properties
| Compound Name | 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea |
| PubChem CID | 159240113 |
| Molecular Formula | C21H37N3O4S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea |
| SMILES | CCN1C(=O)CC(SCCCCCCCCCNC(=O)NC(C)(C)C(C)=O)C1=O |
| InChI | InChI=1S/C21H37N3O4S/c1-5-24-18(26)15-17(19(24)27)29-14-12-10-8-6-7-9-11-13-22-20(28)23-21(3,4)16(2)25/h17H,5-15H2,1-4H3,(H2,22,23,28) |
| InChIKey | KTZBXPNTKGCDBK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea?
The IUPAC name of 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea (CID 159240113) is 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea.
What is the SMILES notation for 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea?
The canonical SMILES for 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea is CCN1C(=O)CC(SCCCCCCCCCNC(=O)NC(C)(C)C(C)=O)C1=O.
What is the InChIKey of 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea?
The InChIKey is KTZBXPNTKGCDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37N3O4S/c1-5-24-18(26)15-17(19(24)27)29-14-12-10-8-6-7-9-11-13-22-20(28)23-21(3,4)16(2)25/h17H,5-15H2,1-4H3,(H2,22,23,28).
What are the key properties of 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea?
1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea has a molecular weight of 427.61 g/mol, XLogP of 3.26, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[9-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylnonyl]-3-(2-methyl-3-oxobutan-2-yl)urea is sourced from PubChem (CID 159240113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).