C20H39FO3Si2 — CID 159241417
(6aR,8S,9S)-9-fluoro-8-methyl-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine (PubChem CID 159241417) has the molecular formula C20H39FO3Si2 and a molecular weight of 402.70 g/mol. Its IUPAC name is (6aR,8S,9S)-9-fluoro-8-methyl-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine.
| Compound Name | (6aR,8S,9S)-9-fluoro-8-methyl-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 159241417 |
| Molecular Formula | C20H39FO3Si2 |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (6aR,8S,9S)-9-fluoro-8-methyl-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocine |
| SMILES | C=C1[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC2[C@@H](F)[C@H]1C |
| InChI | InChI=1S/C20H39FO3Si2/c1-12(2)25(13(3)4)22-11-18-16(9)17(10)19(21)20(18)23-26(24-25,14(5)6)15(7)8/h12-15,17-20H,9,11H2,1-8,10H3/t17-,18-,19-,20?/m0/s1 |
| InChIKey | KUDKUNZORMTSKL-TWQWKPIESA-N |
| XLogP | 6.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|