C25H32N4O2 — CID 15924290
11-[6-[cyclohexyl(methyl)amino]hexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 15924290) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 11-[6-[cyclohexyl(methyl)amino]hexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-[6-[cyclohexyl(methyl)amino]hexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 15924290 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 11-[6-[cyclohexyl(methyl)amino]hexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CN(CCCCCC(=O)N1c2ccccc2C(=O)Nc2cccnc21)C1CCCCC1 |
| InChI | InChI=1S/C25H32N4O2/c1-28(19-11-4-2-5-12-19)18-9-3-6-16-23(30)29-22-15-8-7-13-20(22)25(31)27-21-14-10-17-26-24(21)29/h7-8,10,13-15,17,19H,2-6,9,11-12,16,18H2,1H3,(H,27,31) |
| InChIKey | APQLNZVWFSKQBC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|