C18H16N2O2+2 — CID 159243072
(14E)-2,22-dioxa-9,15-diazoniapentacyclo[13.7.0.01,9.03,8.016,21]docosa-3,5,7,9,14,16,18,20-octaene (PubChem CID 159243072) has the molecular formula C18H16N2O2+2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (14E)-2,22-dioxa-9,15-diazoniapentacyclo[13.7.0.01,9.03,8.016,21]docosa-3,5,7,9,14,16,18,20-octaene.
| Compound Name | (14E)-2,22-dioxa-9,15-diazoniapentacyclo[13.7.0.01,9.03,8.016,21]docosa-3,5,7,9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 159243072 |
| Molecular Formula | C18H16N2O2+2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (14E)-2,22-dioxa-9,15-diazoniapentacyclo[13.7.0.01,9.03,8.016,21]docosa-3,5,7,9,14,16,18,20-octaene |
| SMILES | C1=[N+]2c3ccccc3OC23Oc2ccccc2/[N+]3=C/CCC1 |
| InChI | InChI=1S/C18H16N2O2/c1-6-12-19-14-8-2-4-10-16(14)21-18(19)20(13-7-1)15-9-3-5-11-17(15)22-18/h2-5,8-13H,1,6-7H2/q+2/b19-12-,20-13? |
| InChIKey | WLTVYBMYXKASSG-VUCFFFMQSA-N |
| XLogP | 3.40 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|